Miért?

Mert a tudományt a kérdések viszik előre

Miért pezseg a pezsgőtabletta?

2009.03.15 17:12:58, j_attila

Egyszerű válasz:
A pezsgőtabletták (általában) citromsavat és szódabikarbónát tartalmaznak. Ezek az anyagok vízben oldva reakcióba lépnek egymással, melynek során széndioxidot szabadítanak fel és ez okozza a buborékolást, a pezsgést.
Részletes válasz:
A citromsav (oxi-trikarbalilsav) savas kémhatású anyag, míg a szódabikarbóna (nátrium-hidrogén-karbonát) bázikus kémhatású. Vizes oldatban a savak és bázisok ionjaikra esnek szét [disszociálnak]. Ennek megfelelően a citromsavból H+ ionok és citrát ionok, a szódabikarbónából nátrium és hidrogén-karbonát ionok keletkeznek. Kémiai sav-bázis reakció játszódik le, amelynek során a {citrát ionok a nátrium ionokkal ionos kötést alakítanak ki (nátrium-citrátok keletkeznek). A} H+ ionok a hidrogén-karbonáttal alakítanak ki kovalens kötést, így létrejön a szénsav molekula. A szénsav pedig vízre és széndioxidra bomlik. {Ez egy egyensúlyi megfordítható reakció, amely során folyamatosan történik oda- és visszaalakulás. (A disszociáció is megfordítható reakció.) Ha viszont a széndioxid eltávozik, mivel semmi sem akadályozza meg az eltávozását [nyílt rendszer], akkor egyirányúvá válik a reakció és a lebomlás kerül előtérbe.} A széndioxid eltávozása okozza a buborékolást, a pezsgést.
Képletek:
C3H4 (OH)(COOH) 3 + NaHCO3 -> H2CO3 + C3H4 (OH)(COOH) 2 (COO-)+Na+
C3H4 (OH)(COOH) 3 + 2NaHCO3 -> 2H2CO3 + C3H4(OH)(COOH)(COO-)2+2Na+
C3H4 (OH)(COOH) 3 + 3NaHCO3 -> 3H2CO3 + C3H4(OH)(COO-)3+3Na+
H2CO3 -> H2O + CO2

2009.12.13 12:07:00, j_attila
Kiegészítés

Ma kiegészítettem a képletekkel a részletes leírást.

2010.09.26 22:03:16, j_attila

A szürke betűs részeket kapcsos zárójelek közé tettem és fekete színűre állítottam vissza azért, hogy egységes legyen a jelölés a honlapon.

A hozzászóláshoz lépj be, ha rendelkezel felhasználói névvel.